C17H27N3O3 — CID 97173227
tert-butyl (2S)-2-(3-pyrazin-2-yloxypropyl)piperidine-1-carboxylate (PubChem CID 97173227) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-(3-pyrazin-2-yloxypropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(3-pyrazin-2-yloxypropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97173227 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl (2S)-2-(3-pyrazin-2-yloxypropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1CCCOc1cnccn1 |
| InChI | InChI=1S/C17H27N3O3/c1-17(2,3)23-16(21)20-11-5-4-7-14(20)8-6-12-22-15-13-18-9-10-19-15/h9-10,13-14H,4-8,11-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | MVYVLFIGKLOJOL-AWEZNQCLSA-N |
| XLogP | 3.43 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|