C13H19N3O3 — CID 18391695
tert-butyl (2S)-2-(pyrazin-2-yloxymethyl)azetidine-1-carboxylate (PubChem CID 18391695) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is tert-butyl (2S)-2-(pyrazin-2-yloxymethyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(pyrazin-2-yloxymethyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 18391695 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | tert-butyl (2S)-2-(pyrazin-2-yloxymethyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1COc1cnccn1 |
| InChI | InChI=1S/C13H19N3O3/c1-13(2,3)19-12(17)16-7-4-10(16)9-18-11-8-14-5-6-15-11/h5-6,8,10H,4,7,9H2,1-3H3/t10-/m0/s1 |
| InChIKey | HPYNJJXDGYWOFF-JTQLQIEISA-N |
| XLogP | 1.86 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |