C17H28N2O3Sn — CID 10574471
tert-butyl (2S)-2-[(5-trimethylstannyl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate (PubChem CID 10574471) has the molecular formula C17H28N2O3Sn and a molecular weight of 427.13 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(5-trimethylstannyl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(5-trimethylstannyl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 10574471 |
| Molecular Formula | C17H28N2O3Sn |
| Molecular Weight | 427.13 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | tert-butyl (2S)-2-[(5-trimethylstannyl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1COc1cncc([Sn](C)(C)C)c1 |
| InChI | InChI=1S/C14H19N2O3.3CH3.Sn/c1-14(2,3)19-13(17)16-8-6-11(16)10-18-12-5-4-7-15-9-12;;;;/h5,7,9,11H,6,8,10H2,1-3H3;3*1H3;/t11-;;;;/m0..../s1 |
| InChIKey | HHNYNAVVSDTMQD-HZAYLZKLSA-N |
| XLogP | 3.02 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.13 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |