C20H25N3O3 — CID 22872652
tert-butyl (2S)-2-[[5-(3-aminophenyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate (PubChem CID 22872652) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[5-(3-aminophenyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[5-(3-aminophenyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 22872652 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | tert-butyl (2S)-2-[[5-(3-aminophenyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1COc1cncc(-c2cccc(N)c2)c1 |
| InChI | InChI=1S/C20H25N3O3/c1-20(2,3)26-19(24)23-8-7-17(23)13-25-18-10-15(11-22-12-18)14-5-4-6-16(21)9-14/h4-6,9-12,17H,7-8,13,21H2,1-3H3/t17-/m0/s1 |
| InChIKey | WAZYJDXXRZMYFP-KRWDZBQOSA-N |
| XLogP | 3.72 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|