C29H36N2O4 — CID 143977020
tert-butyl 2-[[5-[3-[(4Z)-4-ethenylhepta-4,6-dienoxy]phenyl]-3-pyridinyl]oxymethyl]azetidine-1-carboxylate (PubChem CID 143977020) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is tert-butyl 2-[[5-[3-[(4Z)-4-ethenylhepta-4,6-dienoxy]phenyl]-3-pyridinyl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[5-[3-[(4Z)-4-ethenylhepta-4,6-dienoxy]phenyl]-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 143977020 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | tert-butyl 2-[[5-[3-[(4Z)-4-ethenylhepta-4,6-dienoxy]phenyl]-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
| SMILES | C=C/C=C(\C=C)CCCOc1cccc(-c2cncc(OCC3CCN3C(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C29H36N2O4/c1-6-10-22(7-2)11-9-16-33-26-13-8-12-23(17-26)24-18-27(20-30-19-24)34-21-25-14-15-31(25)28(32)35-29(3,4)5/h6-8,10,12-13,17-20,25H,1-2,9,11,14-16,21H2,3-5H3/b22-10+ |
| InChIKey | ZDQHBPMYGKNFQS-LSHDLFTRSA-N |
| XLogP | 6.59 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|