C29H34N2O4 — CID 59371677
tert-butyl (2S)-2-[[5-[3-(3-phenylpropoxy)phenyl]-3-pyridinyl]oxymethyl]azetidine-1-carboxylate (PubChem CID 59371677) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[5-[3-(3-phenylpropoxy)phenyl]-3-pyridinyl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[5-[3-(3-phenylpropoxy)phenyl]-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 59371677 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | tert-butyl (2S)-2-[[5-[3-(3-phenylpropoxy)phenyl]-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1COc1cncc(-c2cccc(OCCCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C29H34N2O4/c1-29(2,3)35-28(32)31-15-14-25(31)21-34-27-18-24(19-30-20-27)23-12-7-13-26(17-23)33-16-8-11-22-9-5-4-6-10-22/h4-7,9-10,12-13,17-20,25H,8,11,14-16,21H2,1-3H3/t25-/m0/s1 |
| InChIKey | PTJBUZQVOAPLGM-VWLOTQADSA-N |
| XLogP | 6.15 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|