C16H20N2O3 — CID 56595566
tert-butyl (2S)-2-[(5-ethynyl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate (PubChem CID 56595566) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(5-ethynyl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(5-ethynyl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 56595566 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl (2S)-2-[(5-ethynyl-3-pyridinyl)oxymethyl]azetidine-1-carboxylate |
| SMILES | C#Cc1cncc(OC[C@@H]2CCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-5-12-8-14(10-17-9-12)20-11-13-6-7-18(13)15(19)21-16(2,3)4/h1,8-10,13H,6-7,11H2,2-4H3/t13-/m0/s1 |
| InChIKey | MMWUDCNLXDIVOI-ZDUSSCGKSA-N |
| XLogP | 2.45 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|