C18H29N3O3S — CID 97168445
tert-butyl (2S)-2-[3-(2-methylsulfanylpyrimidin-4-yl)oxypropyl]piperidine-1-carboxylate (PubChem CID 97168445) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(2-methylsulfanylpyrimidin-4-yl)oxypropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-(2-methylsulfanylpyrimidin-4-yl)oxypropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97168445 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | tert-butyl (2S)-2-[3-(2-methylsulfanylpyrimidin-4-yl)oxypropyl]piperidine-1-carboxylate |
| SMILES | CSc1nccc(OCCC[C@@H]2CCCCN2C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C18H29N3O3S/c1-18(2,3)24-17(22)21-12-6-5-8-14(21)9-7-13-23-15-10-11-19-16(20-15)25-4/h10-11,14H,5-9,12-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | KQUUJEPUHKYKFR-AWEZNQCLSA-N |
| XLogP | 4.15 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|