C20H28N2O4 — CID 71631579
tert-butyl 2-[3-(1,3-benzoxazol-2-yloxy)propyl]piperidine-1-carboxylate (PubChem CID 71631579) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is tert-butyl 2-[3-(1,3-benzoxazol-2-yloxy)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-(1,3-benzoxazol-2-yloxy)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71631579 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | tert-butyl 2-[3-(1,3-benzoxazol-2-yloxy)propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CCCOc1nc2ccccc2o1 |
| InChI | InChI=1S/C20H28N2O4/c1-20(2,3)26-19(23)22-13-7-6-9-15(22)10-8-14-24-18-21-16-11-4-5-12-17(16)25-18/h4-5,11-12,15H,6-10,13-14H2,1-3H3 |
| InChIKey | GAQKMCHUDKIIAT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|