C18H23N3O6 — CID 97173584
tert-butyl (2S)-2-[(5-nitro-1,3-benzoxazol-2-yl)oxymethyl]piperidine-1-carboxylate (PubChem CID 97173584) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(5-nitro-1,3-benzoxazol-2-yl)oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(5-nitro-1,3-benzoxazol-2-yl)oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97173584 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | tert-butyl (2S)-2-[(5-nitro-1,3-benzoxazol-2-yl)oxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1COc1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C18H23N3O6/c1-18(2,3)27-17(22)20-9-5-4-6-13(20)11-25-16-19-14-10-12(21(23)24)7-8-15(14)26-16/h7-8,10,13H,4-6,9,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | QTEHVMDTOBDCGX-ZDUSSCGKSA-N |
| XLogP | 3.90 |
| TPSA | 107.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|