C18H21F5N2O5 — CID 86614206
tert-butyl (2S)-2-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 86614206) has the molecular formula C18H21F5N2O5 and a molecular weight of 440.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86614206 |
| Molecular Formula | C18H21F5N2O5 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | tert-butyl (2S)-2-[[5-nitro-2-(1,1,2,2,2-pentafluoroethyl)phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1COc1cc([N+](=O)[O-])ccc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H21F5N2O5/c1-16(2,3)30-15(26)24-8-4-5-12(24)10-29-14-9-11(25(27)28)6-7-13(14)17(19,20)18(21,22)23/h6-7,9,12H,4-5,8,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | OKMYDSUQBOCYDT-LBPRGKRZSA-N |
| XLogP | 5.03 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|