C26H41N3O8 — CID 162029608
tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate;tert-butyl (2S)-2-[(4-nitrophenoxy)methyl]pyrrolidine-1-carboxylate (PubChem CID 162029608) has the molecular formula C26H41N3O8 and a molecular weight of 523.63 g/mol. Its IUPAC name is tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate;tert-butyl (2S)-2-[(4-nitrophenoxy)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate;tert-butyl (2S)-2-[(4-nitrophenoxy)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 162029608 |
| Molecular Formula | C26H41N3O8 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate;tert-butyl (2S)-2-[(4-nitrophenoxy)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CO.CC(C)(C)OC(=O)N1CCC[C@H]1COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H22N2O5.C10H19NO3/c1-16(2,3)23-15(19)17-10-4-5-13(17)11-22-14-8-6-12(7-9-14)18(20)21;1-10(2,3)14-9(13)11-6-4-5-8(11)7-12/h6-9,13H,4-5,10-11H2,1-3H3;8,12H,4-7H2,1-3H3/t13-;8-/m00/s1 |
| InChIKey | YVVPFLJFYVMSNS-GIZSYDTJSA-N |
| XLogP | 4.75 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|