C22H26ClNO4 — CID 44819169
tert-butyl (2S)-2-[[4-(4-chlorophenoxy)phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 44819169) has the molecular formula C22H26ClNO4 and a molecular weight of 403.91 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[4-(4-chlorophenoxy)phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[4-(4-chlorophenoxy)phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 44819169 |
| Molecular Formula | C22H26ClNO4 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | tert-butyl (2S)-2-[[4-(4-chlorophenoxy)phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1COc1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H26ClNO4/c1-22(2,3)28-21(25)24-14-4-5-17(24)15-26-18-10-12-20(13-11-18)27-19-8-6-16(23)7-9-19/h6-13,17H,4-5,14-15H2,1-3H3/t17-/m0/s1 |
| InChIKey | QBCABNLPGBIBEG-KRWDZBQOSA-N |
| XLogP | 5.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |