C28H31NO4 — CID 69001108
tert-butyl 2-[[4-(4-phenylphenoxy)phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 69001108) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl 2-[[4-(4-phenylphenoxy)phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-(4-phenylphenoxy)phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69001108 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | tert-butyl 2-[[4-(4-phenylphenoxy)phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1COc1ccc(Oc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-28(2,3)33-27(30)29-19-7-10-23(29)20-31-24-15-17-26(18-16-24)32-25-13-11-22(12-14-25)21-8-5-4-6-9-21/h4-6,8-9,11-18,23H,7,10,19-20H2,1-3H3 |
| InChIKey | UGGLTOSNERONJW-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |