C32H37NO4 — CID 121266750
tert-butyl 2-[[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 121266750) has the molecular formula C32H37NO4 and a molecular weight of 499.65 g/mol. Its IUPAC name is tert-butyl 2-[[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121266750 |
| Molecular Formula | C32H37NO4 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | tert-butyl 2-[[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCC2CCCN2C(=O)OC(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H37NO4/c1-5-29(23-10-7-6-8-11-23)30(24-13-17-27(34)18-14-24)25-15-19-28(20-16-25)36-22-26-12-9-21-33(26)31(35)37-32(2,3)4/h6-8,10-11,13-20,26,34H,5,9,12,21-22H2,1-4H3 |
| InChIKey | MPWDPYSFOXPAIN-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|