C23H26F3NO4 — CID 69001590
tert-butyl 2-[[4-[4-(trifluoromethyl)phenoxy]phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 69001590) has the molecular formula C23H26F3NO4 and a molecular weight of 437.46 g/mol. Its IUPAC name is tert-butyl 2-[[4-[4-(trifluoromethyl)phenoxy]phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-[4-(trifluoromethyl)phenoxy]phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69001590 |
| Molecular Formula | C23H26F3NO4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | tert-butyl 2-[[4-[4-(trifluoromethyl)phenoxy]phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1COc1ccc(Oc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H26F3NO4/c1-22(2,3)31-21(28)27-14-4-5-17(27)15-29-18-10-12-20(13-11-18)30-19-8-6-16(7-9-19)23(24,25)26/h6-13,17H,4-5,14-15H2,1-3H3 |
| InChIKey | LEYHDGWLIWJFAH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |