C17H22F3NO4 — CID 23081208
tert-butyl 2-[[4-(trifluoromethoxy)phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 23081208) has the molecular formula C17H22F3NO4 and a molecular weight of 361.36 g/mol. Its IUPAC name is tert-butyl 2-[[4-(trifluoromethoxy)phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-(trifluoromethoxy)phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23081208 |
| Molecular Formula | C17H22F3NO4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | tert-butyl 2-[[4-(trifluoromethoxy)phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1COc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3NO4/c1-16(2,3)25-15(22)21-10-4-5-12(21)11-23-13-6-8-14(9-7-13)24-17(18,19)20/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | NROOMFJDBCTVJZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |