C18H24F3NO5 — CID 140989489
tert-butyl 2-hydroxy-3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidine-1-carboxylate (PubChem CID 140989489) has the molecular formula C18H24F3NO5 and a molecular weight of 391.39 g/mol. Its IUPAC name is tert-butyl 2-hydroxy-3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-hydroxy-3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140989489 |
| Molecular Formula | C18H24F3NO5 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | tert-butyl 2-hydroxy-3-[[4-(trifluoromethoxy)phenyl]methoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(OCc2ccc(OC(F)(F)F)cc2)C1O |
| InChI | InChI=1S/C18H24F3NO5/c1-17(2,3)27-16(24)22-10-4-5-14(15(22)23)25-11-12-6-8-13(9-7-12)26-18(19,20)21/h6-9,14-15,23H,4-5,10-11H2,1-3H3 |
| InChIKey | MVASGVLAXWLGCQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |