C20H29NO3 — CID 58739361
tert-butyl 5-phenylmethoxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate (PubChem CID 58739361) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl 5-phenylmethoxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-phenylmethoxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 58739361 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl 5-phenylmethoxy-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2C(OCc3ccccc3)CCC21 |
| InChI | InChI=1S/C20H29NO3/c1-20(2,3)24-19(22)21-13-7-10-16-17(21)11-12-18(16)23-14-15-8-5-4-6-9-15/h4-6,8-9,16-18H,7,10-14H2,1-3H3 |
| InChIKey | QBARAIZVKDHHMX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |