C20H27NO4 — CID 87793968
tert-butyl 2-[(E)-2-methyl-3-oxo-3-phenylmethoxyprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 87793968) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl 2-[(E)-2-methyl-3-oxo-3-phenylmethoxyprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(E)-2-methyl-3-oxo-3-phenylmethoxyprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87793968 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl 2-[(E)-2-methyl-3-oxo-3-phenylmethoxyprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C/C(=C\C1CCCN1C(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H27NO4/c1-15(18(22)24-14-16-9-6-5-7-10-16)13-17-11-8-12-21(17)19(23)25-20(2,3)4/h5-7,9-10,13,17H,8,11-12,14H2,1-4H3/b15-13+ |
| InChIKey | RMMYJNHQHGLVLS-FYWRMAATSA-N |
| XLogP | 4.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|