C16H21NO4 — CID 150439110
2-O-benzyl 1-O-tert-butyl (2R)-azetidine-1,2-dicarboxylate (PubChem CID 150439110) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2R)-azetidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2R)-azetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 150439110 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2R)-azetidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO4/c1-16(2,3)21-15(19)17-10-9-13(17)14(18)20-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3/t13-/m1/s1 |
| InChIKey | HLJUVRGTCJIHRX-CYBMUJFWSA-N |
| XLogP | 2.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |