C25H29NO6 — CID 134230843
2-O,5-O-dibenzyl 1-O-tert-butyl pyrrolidine-1,2,5-tricarboxylate (PubChem CID 134230843) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-O,5-O-dibenzyl 1-O-tert-butyl pyrrolidine-1,2,5-tricarboxylate.
| Compound Name | 2-O,5-O-dibenzyl 1-O-tert-butyl pyrrolidine-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 134230843 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-O,5-O-dibenzyl 1-O-tert-butyl pyrrolidine-1,2,5-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C(=O)OCc2ccccc2)CCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29NO6/c1-25(2,3)32-24(29)26-20(22(27)30-16-18-10-6-4-7-11-18)14-15-21(26)23(28)31-17-19-12-8-5-9-13-19/h4-13,20-21H,14-17H2,1-3H3 |
| InChIKey | GFMYVZXJFSUVGI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|