C18H23NO6 — CID 135148581
1-O-benzyl 2-O,5-O-diethyl pyrrolidine-1,2,5-tricarboxylate (PubChem CID 135148581) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 1-O-benzyl 2-O,5-O-diethyl pyrrolidine-1,2,5-tricarboxylate.
| Compound Name | 1-O-benzyl 2-O,5-O-diethyl pyrrolidine-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 135148581 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-O-benzyl 2-O,5-O-diethyl pyrrolidine-1,2,5-tricarboxylate |
| SMILES | CCOC(=O)C1CCC(C(=O)OCC)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO6/c1-3-23-16(20)14-10-11-15(17(21)24-4-2)19(14)18(22)25-12-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3 |
| InChIKey | FVEFYOOMDFKAQO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|