C16H22N2O4 — CID 141178625
1-O-benzyl 2-O-ethyl (2S)-4-methylpiperazine-1,2-dicarboxylate (PubChem CID 141178625) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-O-benzyl 2-O-ethyl (2S)-4-methylpiperazine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-ethyl (2S)-4-methylpiperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 141178625 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-O-benzyl 2-O-ethyl (2S)-4-methylpiperazine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1CN(C)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22N2O4/c1-3-21-15(19)14-11-17(2)9-10-18(14)16(20)22-12-13-7-5-4-6-8-13/h4-8,14H,3,9-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | HRGBCXVJMWAXKS-AWEZNQCLSA-N |
| XLogP | 1.50 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |