C16H18N2O4 — CID 18391505
1-O-benzyl 2-O-ethyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate (PubChem CID 18391505) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-O-benzyl 2-O-ethyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-ethyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 18391505 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1-O-benzyl 2-O-ethyl (2S,4S)-4-cyanopyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](C#N)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H18N2O4/c1-2-21-15(19)14-8-13(9-17)10-18(14)16(20)22-11-12-6-4-3-5-7-12/h3-7,13-14H,2,8,10-11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | HWSAVXCMWJZFPX-KGLIPLIRSA-N |
| XLogP | 2.10 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |