C21H23NO4 — CID 91191519
1-O-benzyl 2-O-ethyl (2R,3S)-3-(2-phenylethyl)aziridine-1,2-dicarboxylate (PubChem CID 91191519) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-O-benzyl 2-O-ethyl (2R,3S)-3-(2-phenylethyl)aziridine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-ethyl (2R,3S)-3-(2-phenylethyl)aziridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91191519 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-O-benzyl 2-O-ethyl (2R,3S)-3-(2-phenylethyl)aziridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](CCc2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c1-2-25-20(23)19-18(14-13-16-9-5-3-6-10-16)22(19)21(24)26-15-17-11-7-4-8-12-17/h3-12,18-19H,2,13-15H2,1H3/t18-,19+,22?/m0/s1 |
| InChIKey | MXLDZPQAVORAJK-ZKTCVHQMSA-N |
| XLogP | 3.57 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|