C17H19NO6 — CID 16719532
1-O-benzyl 2-O-ethyl (2S,3S,5S)-3,5-diformylpyrrolidine-1,2-dicarboxylate (PubChem CID 16719532) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 1-O-benzyl 2-O-ethyl (2S,3S,5S)-3,5-diformylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-ethyl (2S,3S,5S)-3,5-diformylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 16719532 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-O-benzyl 2-O-ethyl (2S,3S,5S)-3,5-diformylpyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C=O)C[C@@H](C=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H19NO6/c1-2-23-16(21)15-13(9-19)8-14(10-20)18(15)17(22)24-11-12-6-4-3-5-7-12/h3-7,9-10,13-15H,2,8,11H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | OKKCRVCXCRFRCZ-ILXRZTDVSA-N |
| XLogP | 1.34 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|