C15H16N2O4 — CID 141084489
benzyl 5-formyl-3-oxo-1,2,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 141084489) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is benzyl 5-formyl-3-oxo-1,2,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl 5-formyl-3-oxo-1,2,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 141084489 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | benzyl 5-formyl-3-oxo-1,2,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | O=CC1CC2NCC(=O)C2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H16N2O4/c18-8-11-6-12-14(13(19)7-16-12)17(11)15(20)21-9-10-4-2-1-3-5-10/h1-5,8,11-12,14,16H,6-7,9H2 |
| InChIKey | NKUJLVHWJBAQLR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|