C12H12N2O3 — CID 2802741
benzyl 3-oxo-2,4-diazabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 2802741) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is benzyl 3-oxo-2,4-diazabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | benzyl 3-oxo-2,4-diazabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 2802741 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | benzyl 3-oxo-2,4-diazabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | O=C1NC2CC2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H12N2O3/c15-11-13-9-6-10(9)14(11)12(16)17-7-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,13,15) |
| InChIKey | MTQBCNWSXOYUJM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |