C21H22N2O6 — CID 154704878
dibenzyl 5,6-dihydroxy-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 154704878) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is dibenzyl 5,6-dihydroxy-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dibenzyl 5,6-dihydroxy-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 154704878 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | dibenzyl 5,6-dihydroxy-2,3-diazabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2CC(C(O)C2O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22N2O6/c24-18-16-11-17(19(18)25)23(21(27)29-13-15-9-5-2-6-10-15)22(16)20(26)28-12-14-7-3-1-4-8-14/h1-10,16-19,24-25H,11-13H2 |
| InChIKey | WHPRXQGDHSBBOF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |