C30H33N3O6 — CID 54056276
tribenzyl 1,4,7-triazonane-1,4,7-tricarboxylate (PubChem CID 54056276) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is tribenzyl 1,4,7-triazonane-1,4,7-tricarboxylate.
| Compound Name | tribenzyl 1,4,7-triazonane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 54056276 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | tribenzyl 1,4,7-triazonane-1,4,7-tricarboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(C(=O)OCc2ccccc2)CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C30H33N3O6/c34-28(37-22-25-10-4-1-5-11-25)31-16-18-32(29(35)38-23-26-12-6-2-7-13-26)20-21-33(19-17-31)30(36)39-24-27-14-8-3-9-15-27/h1-15H,16-24H2 |
| InChIKey | LWMGLWCICKWIHO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|