C24H34Cl2N4O4 — CID 172851166
dibenzyl 1,7-diaza-4,10-diazoniacyclododecane-1,7-dicarboxylate dichloride (PubChem CID 172851166) has the molecular formula C24H34Cl2N4O4 and a molecular weight of 513.47 g/mol. Its IUPAC name is dibenzyl 1,7-diaza-4,10-diazoniacyclododecane-1,7-dicarboxylate dichloride.
| Compound Name | dibenzyl 1,7-diaza-4,10-diazoniacyclododecane-1,7-dicarboxylate dichloride |
|---|---|
| PubChem CID | 172851166 |
| Molecular Formula | C24H34Cl2N4O4 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | dibenzyl 1,7-diaza-4,10-diazoniacyclododecane-1,7-dicarboxylate dichloride |
| SMILES | O=C(OCc1ccccc1)N1CC[NH2+]CCN(C(=O)OCc2ccccc2)CC[NH2+]CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C24H32N4O4.2ClH/c29-23(31-19-21-7-3-1-4-8-21)27-15-11-25-13-17-28(18-14-26-12-16-27)24(30)32-20-22-9-5-2-6-10-22;;/h1-10,25-26H,11-20H2;2*1H |
| InChIKey | YBXLBPFXNJFALP-UHFFFAOYSA-N |
| XLogP | -5.59 |
| TPSA | 92.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | -5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |