C16H26N4O2 — CID 11154253
benzyl 1,4,7,10-tetrazacyclododecane-1-carboxylate (PubChem CID 11154253) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is benzyl 1,4,7,10-tetrazacyclododecane-1-carboxylate.
| Compound Name | benzyl 1,4,7,10-tetrazacyclododecane-1-carboxylate |
|---|---|
| PubChem CID | 11154253 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | benzyl 1,4,7,10-tetrazacyclododecane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C16H26N4O2/c21-16(22-14-15-4-2-1-3-5-15)20-12-10-18-8-6-17-7-9-19-11-13-20/h1-5,17-19H,6-14H2 |
| InChIKey | PQYSJDPXBKWTBQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |