About (4-hydroxyphenyl)methyl piperazine-1-carboxylate
(4-hydroxyphenyl)methyl piperazine-1-carboxylate (PubChem CID 141088102) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is (4-hydroxyphenyl)methyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (4-hydroxyphenyl)methyl piperazine-1-carboxylate |
| PubChem CID | 141088102 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (4-hydroxyphenyl)methyl piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccc(O)cc1)N1CCNCC1 |
| InChI | InChI=1S/C12H16N2O3/c15-11-3-1-10(2-4-11)9-17-12(16)14-7-5-13-6-8-14/h1-4,13,15H,5-9H2 |
| InChIKey | KNQZHSUBMOOBBV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-hydroxyphenyl)methyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl)methyl piperazine-1-carboxylate?
The IUPAC name of (4-hydroxyphenyl)methyl piperazine-1-carboxylate (CID 141088102) is (4-hydroxyphenyl)methyl piperazine-1-carboxylate.
What is the SMILES notation for (4-hydroxyphenyl)methyl piperazine-1-carboxylate?
The canonical SMILES for (4-hydroxyphenyl)methyl piperazine-1-carboxylate is O=C(OCc1ccc(O)cc1)N1CCNCC1.
What is the InChIKey of (4-hydroxyphenyl)methyl piperazine-1-carboxylate?
The InChIKey is KNQZHSUBMOOBBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3/c15-11-3-1-10(2-4-11)9-17-12(16)14-7-5-13-6-8-14/h1-4,13,15H,5-9H2.
What are the key properties of (4-hydroxyphenyl)methyl piperazine-1-carboxylate?
(4-hydroxyphenyl)methyl piperazine-1-carboxylate has a molecular weight of 236.27 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl)methyl piperazine-1-carboxylate is sourced from PubChem (CID 141088102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).