C14H17F3N2O2 — CID 66720556
[4-methyl-3-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate (PubChem CID 66720556) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is [4-methyl-3-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate.
| Compound Name | [4-methyl-3-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 66720556 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [4-methyl-3-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate |
| SMILES | Cc1ccc(COC(=O)N2CCNCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O2/c1-10-2-3-11(8-12(10)14(15,16)17)9-21-13(20)19-6-4-18-5-7-19/h2-3,8,18H,4-7,9H2,1H3 |
| InChIKey | FAIRTFNEFFQMDO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |