(2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate

C16H24N2O2 — CID 90924240

IUPAC(2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate
SMILESCc1cc(C)c(COC(=O)N2CCCNCC2)c(C)c1
InChIInChI=1S/C16H24N2O2/c1-12-9-13(2)15(14(3)10-12)11-20-16(19)18-7-4-5-17-6-8-18/h9-10,17H,4-8,11H2,1-3H3
InChIKeyJOGOHNIEHUNXEK-UHFFFAOYSA-N
MW276.38 g/mol
LogP2.54
Rot. Bonds2

About (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate

(2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate (PubChem CID 90924240) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate.

Molecular Properties

Compound Name(2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate
PubChem CID90924240
Molecular FormulaC16H24N2O2
Molecular Weight276.38 g/mol
Exact Mass276.18
IUPAC Name(2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate
SMILESCc1cc(C)c(COC(=O)N2CCCNCC2)c(C)c1
InChIInChI=1S/C16H24N2O2/c1-12-9-13(2)15(14(3)10-12)11-20-16(19)18-7-4-5-17-6-8-18/h9-10,17H,4-8,11H2,1-3H3
InChIKeyJOGOHNIEHUNXEK-UHFFFAOYSA-N
XLogP2.54
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.38
LogP ≤ 52.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate?
The IUPAC name of (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate (CID 90924240) is (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate.
What is the SMILES notation for (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate?
The canonical SMILES for (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate is Cc1cc(C)c(COC(=O)N2CCCNCC2)c(C)c1.
What is the InChIKey of (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate?
The InChIKey is JOGOHNIEHUNXEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-12-9-13(2)15(14(3)10-12)11-20-16(19)18-7-4-5-17-6-8-18/h9-10,17H,4-8,11H2,1-3H3.
What are the key properties of (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate?
(2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate has a molecular weight of 276.38 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-trimethylphenyl)methyl 1,4-diazepane-1-carboxylate is sourced from PubChem (CID 90924240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).