C11H16N2O3 — CID 82287342
furan-2-ylmethyl 1,4-diazepane-1-carboxylate (PubChem CID 82287342) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is furan-2-ylmethyl 1,4-diazepane-1-carboxylate.
| Compound Name | furan-2-ylmethyl 1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 82287342 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | furan-2-ylmethyl 1,4-diazepane-1-carboxylate |
| SMILES | O=C(OCc1ccco1)N1CCCNCC1 |
| InChI | InChI=1S/C11H16N2O3/c14-11(13-6-2-4-12-5-7-13)16-9-10-3-1-8-15-10/h1,3,8,12H,2,4-7,9H2 |
| InChIKey | GJVKYNXVLBFKAA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |