furan-2-ylmethyl 1,4-diazepane-1-carboxylate

C11H16N2O3 — CID 82287342

IUPACfuran-2-ylmethyl 1,4-diazepane-1-carboxylate
SMILESO=C(OCc1ccco1)N1CCCNCC1
InChIInChI=1S/C11H16N2O3/c14-11(13-6-2-4-12-5-7-13)16-9-10-3-1-8-15-10/h1,3,8,12H,2,4-7,9H2
InChIKeyGJVKYNXVLBFKAA-UHFFFAOYSA-N
MW224.26 g/mol
LogP1.21
Rot. Bonds2

About furan-2-ylmethyl 1,4-diazepane-1-carboxylate

furan-2-ylmethyl 1,4-diazepane-1-carboxylate (PubChem CID 82287342) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is furan-2-ylmethyl 1,4-diazepane-1-carboxylate.

Molecular Properties

Compound Namefuran-2-ylmethyl 1,4-diazepane-1-carboxylate
PubChem CID82287342
Molecular FormulaC11H16N2O3
Molecular Weight224.26 g/mol
Exact Mass224.12
IUPAC Namefuran-2-ylmethyl 1,4-diazepane-1-carboxylate
SMILESO=C(OCc1ccco1)N1CCCNCC1
InChIInChI=1S/C11H16N2O3/c14-11(13-6-2-4-12-5-7-13)16-9-10-3-1-8-15-10/h1,3,8,12H,2,4-7,9H2
InChIKeyGJVKYNXVLBFKAA-UHFFFAOYSA-N
XLogP1.21
TPSA54.71 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.26
LogP ≤ 51.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze furan-2-ylmethyl 1,4-diazepane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of furan-2-ylmethyl 1,4-diazepane-1-carboxylate?
The IUPAC name of furan-2-ylmethyl 1,4-diazepane-1-carboxylate (CID 82287342) is furan-2-ylmethyl 1,4-diazepane-1-carboxylate.
What is the SMILES notation for furan-2-ylmethyl 1,4-diazepane-1-carboxylate?
The canonical SMILES for furan-2-ylmethyl 1,4-diazepane-1-carboxylate is O=C(OCc1ccco1)N1CCCNCC1.
What is the InChIKey of furan-2-ylmethyl 1,4-diazepane-1-carboxylate?
The InChIKey is GJVKYNXVLBFKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c14-11(13-6-2-4-12-5-7-13)16-9-10-3-1-8-15-10/h1,3,8,12H,2,4-7,9H2.
What are the key properties of furan-2-ylmethyl 1,4-diazepane-1-carboxylate?
furan-2-ylmethyl 1,4-diazepane-1-carboxylate has a molecular weight of 224.26 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-ylmethyl 1,4-diazepane-1-carboxylate is sourced from PubChem (CID 82287342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).