C16H24N2O5 — CID 91448693
(2,4,6-trimethoxyphenyl)methyl 1,4-diazepane-1-carboxylate (PubChem CID 91448693) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2,4,6-trimethoxyphenyl)methyl 1,4-diazepane-1-carboxylate.
| Compound Name | (2,4,6-trimethoxyphenyl)methyl 1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 91448693 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (2,4,6-trimethoxyphenyl)methyl 1,4-diazepane-1-carboxylate |
| SMILES | COc1cc(OC)c(COC(=O)N2CCCNCC2)c(OC)c1 |
| InChI | InChI=1S/C16H24N2O5/c1-20-12-9-14(21-2)13(15(10-12)22-3)11-23-16(19)18-7-4-5-17-6-8-18/h9-10,17H,4-8,11H2,1-3H3 |
| InChIKey | IJQMLEAMCFVJPH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |