C22H25F3N2O5 — CID 6735891
(2,3,6-trifluorophenyl)methyl 4-[(2,4,6-trimethoxyphenyl)methyl]piperazine-1-carboxylate (PubChem CID 6735891) has the molecular formula C22H25F3N2O5 and a molecular weight of 454.45 g/mol. Its IUPAC name is (2,3,6-trifluorophenyl)methyl 4-[(2,4,6-trimethoxyphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | (2,3,6-trifluorophenyl)methyl 4-[(2,4,6-trimethoxyphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 6735891 |
| Molecular Formula | C22H25F3N2O5 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (2,3,6-trifluorophenyl)methyl 4-[(2,4,6-trimethoxyphenyl)methyl]piperazine-1-carboxylate |
| SMILES | COc1cc(OC)c(CN2CCN(C(=O)OCc3c(F)ccc(F)c3F)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H25F3N2O5/c1-29-14-10-19(30-2)15(20(11-14)31-3)12-26-6-8-27(9-7-26)22(28)32-13-16-17(23)4-5-18(24)21(16)25/h4-5,10-11H,6-9,12-13H2,1-3H3 |
| InChIKey | JRKOUFXHVCCHBQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|