C21H25FN2O4 — CID 46884235
(2-fluorophenyl)-[2-hydroxy-4,6-dimethoxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone (PubChem CID 46884235) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is (2-fluorophenyl)-[2-hydroxy-4,6-dimethoxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone.
| Compound Name | (2-fluorophenyl)-[2-hydroxy-4,6-dimethoxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 46884235 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (2-fluorophenyl)-[2-hydroxy-4,6-dimethoxy-3-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone |
| SMILES | COc1cc(OC)c(C(=O)c2ccccc2F)c(O)c1CN1CCN(C)CC1 |
| InChI | InChI=1S/C21H25FN2O4/c1-23-8-10-24(11-9-23)13-15-17(27-2)12-18(28-3)19(21(15)26)20(25)14-6-4-5-7-16(14)22/h4-7,12,26H,8-11,13H2,1-3H3 |
| InChIKey | PQPMNEIPZJLZLK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|