C27H36N2O5 — CID 57236214
bis[3,5-dimethoxy-4-(pyrrolidin-1-ylmethyl)phenyl]methanone (PubChem CID 57236214) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is bis[3,5-dimethoxy-4-(pyrrolidin-1-ylmethyl)phenyl]methanone.
| Compound Name | bis[3,5-dimethoxy-4-(pyrrolidin-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 57236214 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | bis[3,5-dimethoxy-4-(pyrrolidin-1-ylmethyl)phenyl]methanone |
| SMILES | COc1cc(C(=O)c2cc(OC)c(CN3CCCC3)c(OC)c2)cc(OC)c1CN1CCCC1 |
| InChI | InChI=1S/C27H36N2O5/c1-31-23-13-19(14-24(32-2)21(23)17-28-9-5-6-10-28)27(30)20-15-25(33-3)22(26(16-20)34-4)18-29-11-7-8-12-29/h13-16H,5-12,17-18H2,1-4H3 |
| InChIKey | SEKRPJLQNBGWEV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |