C15H20F3NO5S — CID 58266306
[3,5-dimethoxy-4-(piperidin-1-ylmethyl)phenyl] trifluoromethanesulfonate (PubChem CID 58266306) has the molecular formula C15H20F3NO5S and a molecular weight of 383.39 g/mol. Its IUPAC name is [3,5-dimethoxy-4-(piperidin-1-ylmethyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dimethoxy-4-(piperidin-1-ylmethyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58266306 |
| Molecular Formula | C15H20F3NO5S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [3,5-dimethoxy-4-(piperidin-1-ylmethyl)phenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)cc(OC)c1CN1CCCCC1 |
| InChI | InChI=1S/C15H20F3NO5S/c1-22-13-8-11(24-25(20,21)15(16,17)18)9-14(23-2)12(13)10-19-6-4-3-5-7-19/h8-9H,3-7,10H2,1-2H3 |
| InChIKey | DIYPQAHJKPNPMS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|