C12H7F3O6S — CID 10936599
(4-methoxy-5,8-dioxonaphthalen-2-yl) trifluoromethanesulfonate (PubChem CID 10936599) has the molecular formula C12H7F3O6S and a molecular weight of 336.24 g/mol. Its IUPAC name is (4-methoxy-5,8-dioxonaphthalen-2-yl) trifluoromethanesulfonate.
| Compound Name | (4-methoxy-5,8-dioxonaphthalen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10936599 |
| Molecular Formula | C12H7F3O6S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | (4-methoxy-5,8-dioxonaphthalen-2-yl) trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)cc2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C12H7F3O6S/c1-20-10-5-6(21-22(18,19)12(13,14)15)4-7-8(16)2-3-9(17)11(7)10/h2-5H,1H3 |
| InChIKey | MXGANOPSFWDLMA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|