C10H9F3O6S — CID 11045242
(4-formyl-2,6-dimethoxyphenyl) trifluoromethanesulfonate (PubChem CID 11045242) has the molecular formula C10H9F3O6S and a molecular weight of 314.24 g/mol. Its IUPAC name is (4-formyl-2,6-dimethoxyphenyl) trifluoromethanesulfonate.
| Compound Name | (4-formyl-2,6-dimethoxyphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11045242 |
| Molecular Formula | C10H9F3O6S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | (4-formyl-2,6-dimethoxyphenyl) trifluoromethanesulfonate |
| SMILES | COc1cc(C=O)cc(OC)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O6S/c1-17-7-3-6(5-14)4-8(18-2)9(7)19-20(15,16)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | SFRRQYFIDKRUCA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|