C12H16O7S — CID 10711213
3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid (PubChem CID 10711213) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid.
| Compound Name | 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 10711213 |
| Molecular Formula | C12H16O7S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid |
| SMILES | COc1cc(C=O)cc(OCCCS(=O)(=O)O)c1OC |
| InChI | InChI=1S/C12H16O7S/c1-17-10-6-9(8-13)7-11(12(10)18-2)19-4-3-5-20(14,15)16/h6-8H,3-5H2,1-2H3,(H,14,15,16) |
| InChIKey | VLXGXSKBLTWDBD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|