3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid

C12H16O7S — CID 10711213

IUPAC3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid
SMILESCOc1cc(C=O)cc(OCCCS(=O)(=O)O)c1OC
InChIInChI=1S/C12H16O7S/c1-17-10-6-9(8-13)7-11(12(10)18-2)19-4-3-5-20(14,15)16/h6-8H,3-5H2,1-2H3,(H,14,15,16)
InChIKeyVLXGXSKBLTWDBD-UHFFFAOYSA-N
MW304.32 g/mol
LogP1.17
Rot. Bonds8

About 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid

3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid (PubChem CID 10711213) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid.

Molecular Properties

Compound Name3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid
PubChem CID10711213
Molecular FormulaC12H16O7S
Molecular Weight304.32 g/mol
Exact Mass304.06
IUPAC Name3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid
SMILESCOc1cc(C=O)cc(OCCCS(=O)(=O)O)c1OC
InChIInChI=1S/C12H16O7S/c1-17-10-6-9(8-13)7-11(12(10)18-2)19-4-3-5-20(14,15)16/h6-8H,3-5H2,1-2H3,(H,14,15,16)
InChIKeyVLXGXSKBLTWDBD-UHFFFAOYSA-N
XLogP1.17
TPSA99.13 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.32
LogP ≤ 51.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid?
The IUPAC name of 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid (CID 10711213) is 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid.
What is the SMILES notation for 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid?
The canonical SMILES for 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid is COc1cc(C=O)cc(OCCCS(=O)(=O)O)c1OC.
What is the InChIKey of 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid?
The InChIKey is VLXGXSKBLTWDBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O7S/c1-17-10-6-9(8-13)7-11(12(10)18-2)19-4-3-5-20(14,15)16/h6-8H,3-5H2,1-2H3,(H,14,15,16).
What are the key properties of 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid?
3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid has a molecular weight of 304.32 g/mol, XLogP of 1.17, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-formyl-2,3-dimethoxyphenoxy)propane-1-sulfonic acid is sourced from PubChem (CID 10711213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).