C13H19NO4 — CID 43516597
4-[2-(dimethylamino)ethoxy]-3,5-dimethoxybenzaldehyde (PubChem CID 43516597) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-3,5-dimethoxybenzaldehyde.
| Compound Name | 4-[2-(dimethylamino)ethoxy]-3,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 43516597 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-3,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(OC)c1OCCN(C)C |
| InChI | InChI=1S/C13H19NO4/c1-14(2)5-6-18-13-11(16-3)7-10(9-15)8-12(13)17-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | LIDPJEIGSPOPNP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|