C28H30O10 — CID 21037530
4-[[4-[(4-formyl-2,6-dimethoxyphenoxy)methyl]-2,5-dimethoxyphenyl]methoxy]-3,5-dimethoxybenzaldehyde (PubChem CID 21037530) has the molecular formula C28H30O10 and a molecular weight of 526.54 g/mol. Its IUPAC name is 4-[[4-[(4-formyl-2,6-dimethoxyphenoxy)methyl]-2,5-dimethoxyphenyl]methoxy]-3,5-dimethoxybenzaldehyde.
| Compound Name | 4-[[4-[(4-formyl-2,6-dimethoxyphenoxy)methyl]-2,5-dimethoxyphenyl]methoxy]-3,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 21037530 |
| Molecular Formula | C28H30O10 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 4-[[4-[(4-formyl-2,6-dimethoxyphenoxy)methyl]-2,5-dimethoxyphenyl]methoxy]-3,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(COc2c(OC)cc(C=O)cc2OC)c(OC)cc1COc1c(OC)cc(C=O)cc1OC |
| InChI | InChI=1S/C28H30O10/c1-31-21-11-20(16-38-28-25(35-5)9-18(14-30)10-26(28)36-6)22(32-2)12-19(21)15-37-27-23(33-3)7-17(13-29)8-24(27)34-4/h7-14H,15-16H2,1-6H3 |
| InChIKey | LCVGWKQKBPIEPS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|