C11H14O4 — CID 117275838
3,4-dimethoxy-5-(methoxymethyl)benzaldehyde (PubChem CID 117275838) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3,4-dimethoxy-5-(methoxymethyl)benzaldehyde.
| Compound Name | 3,4-dimethoxy-5-(methoxymethyl)benzaldehyde |
|---|---|
| PubChem CID | 117275838 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3,4-dimethoxy-5-(methoxymethyl)benzaldehyde |
| SMILES | COCc1cc(C=O)cc(OC)c1OC |
| InChI | InChI=1S/C11H14O4/c1-13-7-9-4-8(6-12)5-10(14-2)11(9)15-3/h4-6H,7H2,1-3H3 |
| InChIKey | RSAYNAAMSDPASU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|