C9H9IO3 — CID 11300800
4-iodo-3,5-dimethoxybenzaldehyde (PubChem CID 11300800) has the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. Its IUPAC name is 4-iodo-3,5-dimethoxybenzaldehyde.
| Compound Name | 4-iodo-3,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 11300800 |
| Molecular Formula | C9H9IO3 |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | 4-iodo-3,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(OC)c1I |
| InChI | InChI=1S/C9H9IO3/c1-12-7-3-6(5-11)4-8(13-2)9(7)10/h3-5H,1-2H3 |
| InChIKey | YXRBJODOAIIFRR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|