C8H6Cl2O2 — CID 21483929
3,4-dichloro-5-methoxybenzaldehyde (PubChem CID 21483929) has the molecular formula C8H6Cl2O2 and a molecular weight of 205.04 g/mol. Its IUPAC name is 3,4-dichloro-5-methoxybenzaldehyde.
| Compound Name | 3,4-dichloro-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 21483929 |
| Molecular Formula | C8H6Cl2O2 |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.97 |
| IUPAC Name | 3,4-dichloro-5-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)cc(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2O2/c1-12-7-3-5(4-11)2-6(9)8(7)10/h2-4H,1H3 |
| InChIKey | REALYIFKBRVZLC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|